About (3-ethyl-2,6-dimethylquinolin-4-yl)sulfanylmethanediamine;hydrochloride
(3-ethyl-2,6-dimethylquinolin-4-yl)sulfanylmethanediamine;hydrochloride (PubChem CID 126467782) has the molecular formula C14H20ClN3S
and a molecular weight of 297.86 g/mol. Its IUPAC name is (3-ethyl-2,6-dimethylquinolin-4-yl)sulfanylmethanediamine;hydrochloride.
Molecular Properties
| Compound Name | (3-ethyl-2,6-dimethylquinolin-4-yl)sulfanylmethanediamine;hydrochloride |
| PubChem CID | 126467782 |
| Molecular Formula | C14H20ClN3S |
| Molecular Weight | 297.86 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | (3-ethyl-2,6-dimethylquinolin-4-yl)sulfanylmethanediamine;hydrochloride |
| SMILES | CCc1c(C)nc2ccc(C)cc2c1SC(N)N.Cl |
| InChI | InChI=1S/C14H19N3S.ClH/c1-4-10-9(3)17-12-6-5-8(2)7-11(12)13(10)18-14(15)16;/h5-7,14H,4,15-16H2,1-3H3;1H |
| InChIKey | PXRCNAGMDMNYIG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.86 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (3-ethyl-2,6-dimethylquinolin-4-yl)sulfanylmethanediamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethyl-2,6-dimethylquinolin-4-yl)sulfanylmethanediamine;hydrochloride?
The IUPAC name of (3-ethyl-2,6-dimethylquinolin-4-yl)sulfanylmethanediamine;hydrochloride (CID 126467782) is (3-ethyl-2,6-dimethylquinolin-4-yl)sulfanylmethanediamine;hydrochloride.
What is the SMILES notation for (3-ethyl-2,6-dimethylquinolin-4-yl)sulfanylmethanediamine;hydrochloride?
The canonical SMILES for (3-ethyl-2,6-dimethylquinolin-4-yl)sulfanylmethanediamine;hydrochloride is CCc1c(C)nc2ccc(C)cc2c1SC(N)N.Cl.
What is the InChIKey of (3-ethyl-2,6-dimethylquinolin-4-yl)sulfanylmethanediamine;hydrochloride?
The InChIKey is PXRCNAGMDMNYIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3S.ClH/c1-4-10-9(3)17-12-6-5-8(2)7-11(12)13(10)18-14(15)16;/h5-7,14H,4,15-16H2,1-3H3;1H.
What are the key properties of (3-ethyl-2,6-dimethylquinolin-4-yl)sulfanylmethanediamine;hydrochloride?
(3-ethyl-2,6-dimethylquinolin-4-yl)sulfanylmethanediamine;hydrochloride has a molecular weight of 297.86 g/mol, XLogP of 3.13, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethyl-2,6-dimethylquinolin-4-yl)sulfanylmethanediamine;hydrochloride is sourced from PubChem (CID 126467782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).