C14H17ClN2O5S — CID 126467892
2-amino-3-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid;hydrochloride (PubChem CID 126467892) has the molecular formula C14H17ClN2O5S and a molecular weight of 360.82 g/mol. Its IUPAC name is 2-amino-3-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid;hydrochloride.
| Compound Name | 2-amino-3-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid;hydrochloride |
|---|---|
| PubChem CID | 126467892 |
| Molecular Formula | C14H17ClN2O5S |
| Molecular Weight | 360.82 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 2-amino-3-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid;hydrochloride |
| SMILES | COc1ccc(N2C(=O)CC(SCC(N)C(=O)O)C2=O)cc1.Cl |
| InChI | InChI=1S/C14H16N2O5S.ClH/c1-21-9-4-2-8(3-5-9)16-12(17)6-11(13(16)18)22-7-10(15)14(19)20;/h2-5,10-11H,6-7,15H2,1H3,(H,19,20);1H |
| InChIKey | KCCUSAOMAIZCJH-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.82 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|