C12H16N4O — CID 126470550
cyclohex-3-en-1-yl(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methanone (PubChem CID 126470550) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is cyclohex-3-en-1-yl(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methanone.
| Compound Name | cyclohex-3-en-1-yl(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methanone |
|---|---|
| PubChem CID | 126470550 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | cyclohex-3-en-1-yl(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methanone |
| SMILES | O=C(C1CC=CCC1)N1CCn2cnnc2C1 |
| InChI | InChI=1S/C12H16N4O/c17-12(10-4-2-1-3-5-10)15-6-7-16-9-13-14-11(16)8-15/h1-2,9-10H,3-8H2 |
| InChIKey | HCGQMIYJCSJPHX-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|