About 3-(furan-2-yl)-N-(thiophen-2-ylmethyl)imidazo[1,2-b]pyridazin-6-amine
3-(furan-2-yl)-N-(thiophen-2-ylmethyl)imidazo[1,2-b]pyridazin-6-amine (PubChem CID 126470716) has the molecular formula C15H12N4OS
and a molecular weight of 296.36 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-(thiophen-2-ylmethyl)imidazo[1,2-b]pyridazin-6-amine.
Molecular Properties
| Compound Name | 3-(furan-2-yl)-N-(thiophen-2-ylmethyl)imidazo[1,2-b]pyridazin-6-amine |
| PubChem CID | 126470716 |
| Molecular Formula | C15H12N4OS |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 3-(furan-2-yl)-N-(thiophen-2-ylmethyl)imidazo[1,2-b]pyridazin-6-amine |
| SMILES | c1coc(-c2cnc3ccc(NCc4cccs4)nn23)c1 |
| InChI | InChI=1S/C15H12N4OS/c1-4-13(20-7-1)12-10-17-15-6-5-14(18-19(12)15)16-9-11-3-2-8-21-11/h1-8,10H,9H2,(H,16,18) |
| InChIKey | XRVIARZNQHCEON-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 55.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(furan-2-yl)-N-(thiophen-2-ylmethyl)imidazo[1,2-b]pyridazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(furan-2-yl)-N-(thiophen-2-ylmethyl)imidazo[1,2-b]pyridazin-6-amine?
The IUPAC name of 3-(furan-2-yl)-N-(thiophen-2-ylmethyl)imidazo[1,2-b]pyridazin-6-amine (CID 126470716) is 3-(furan-2-yl)-N-(thiophen-2-ylmethyl)imidazo[1,2-b]pyridazin-6-amine.
What is the SMILES notation for 3-(furan-2-yl)-N-(thiophen-2-ylmethyl)imidazo[1,2-b]pyridazin-6-amine?
The canonical SMILES for 3-(furan-2-yl)-N-(thiophen-2-ylmethyl)imidazo[1,2-b]pyridazin-6-amine is c1coc(-c2cnc3ccc(NCc4cccs4)nn23)c1.
What is the InChIKey of 3-(furan-2-yl)-N-(thiophen-2-ylmethyl)imidazo[1,2-b]pyridazin-6-amine?
The InChIKey is XRVIARZNQHCEON-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N4OS/c1-4-13(20-7-1)12-10-17-15-6-5-14(18-19(12)15)16-9-11-3-2-8-21-11/h1-8,10H,9H2,(H,16,18).
What are the key properties of 3-(furan-2-yl)-N-(thiophen-2-ylmethyl)imidazo[1,2-b]pyridazin-6-amine?
3-(furan-2-yl)-N-(thiophen-2-ylmethyl)imidazo[1,2-b]pyridazin-6-amine has a molecular weight of 296.36 g/mol, XLogP of 3.66, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(furan-2-yl)-N-(thiophen-2-ylmethyl)imidazo[1,2-b]pyridazin-6-amine is sourced from PubChem (CID 126470716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).