C16H15N3O3 — CID 126470919
N-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 126470919) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 126470919 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cnc3ccccn23)cc1OC |
| InChI | InChI=1S/C16H15N3O3/c1-21-13-7-6-11(9-14(13)22-2)18-16(20)12-10-17-15-5-3-4-8-19(12)15/h3-10H,1-2H3,(H,18,20) |
| InChIKey | QKAJNMRMHHDXSQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |