About 3-[3,5-bis(trifluoromethyl)phenyl]-8-(4-methylpiperazin-1-yl)imidazo[1,2-a]pyrazine
3-[3,5-bis(trifluoromethyl)phenyl]-8-(4-methylpiperazin-1-yl)imidazo[1,2-a]pyrazine (PubChem CID 126471827) has the molecular formula C19H17F6N5
and a molecular weight of 429.37 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]-8-(4-methylpiperazin-1-yl)imidazo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]-8-(4-methylpiperazin-1-yl)imidazo[1,2-a]pyrazine |
| PubChem CID | 126471827 |
| Molecular Formula | C19H17F6N5 |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]-8-(4-methylpiperazin-1-yl)imidazo[1,2-a]pyrazine |
| SMILES | CN1CCN(c2nccn3c(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)cnc23)CC1 |
| InChI | InChI=1S/C19H17F6N5/c1-28-4-6-29(7-5-28)16-17-27-11-15(30(17)3-2-26-16)12-8-13(18(20,21)22)10-14(9-12)19(23,24)25/h2-3,8-11H,4-7H2,1H3 |
| InChIKey | YPMBHLFPFVWXBN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 36.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[3,5-bis(trifluoromethyl)phenyl]-8-(4-methylpiperazin-1-yl)imidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,5-bis(trifluoromethyl)phenyl]-8-(4-methylpiperazin-1-yl)imidazo[1,2-a]pyrazine?
The IUPAC name of 3-[3,5-bis(trifluoromethyl)phenyl]-8-(4-methylpiperazin-1-yl)imidazo[1,2-a]pyrazine (CID 126471827) is 3-[3,5-bis(trifluoromethyl)phenyl]-8-(4-methylpiperazin-1-yl)imidazo[1,2-a]pyrazine.
What is the SMILES notation for 3-[3,5-bis(trifluoromethyl)phenyl]-8-(4-methylpiperazin-1-yl)imidazo[1,2-a]pyrazine?
The canonical SMILES for 3-[3,5-bis(trifluoromethyl)phenyl]-8-(4-methylpiperazin-1-yl)imidazo[1,2-a]pyrazine is CN1CCN(c2nccn3c(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)cnc23)CC1.
What is the InChIKey of 3-[3,5-bis(trifluoromethyl)phenyl]-8-(4-methylpiperazin-1-yl)imidazo[1,2-a]pyrazine?
The InChIKey is YPMBHLFPFVWXBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17F6N5/c1-28-4-6-29(7-5-28)16-17-27-11-15(30(17)3-2-26-16)12-8-13(18(20,21)22)10-14(9-12)19(23,24)25/h2-3,8-11H,4-7H2,1H3.
What are the key properties of 3-[3,5-bis(trifluoromethyl)phenyl]-8-(4-methylpiperazin-1-yl)imidazo[1,2-a]pyrazine?
3-[3,5-bis(trifluoromethyl)phenyl]-8-(4-methylpiperazin-1-yl)imidazo[1,2-a]pyrazine has a molecular weight of 429.37 g/mol, XLogP of 4.19, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-bis(trifluoromethyl)phenyl]-8-(4-methylpiperazin-1-yl)imidazo[1,2-a]pyrazine is sourced from PubChem (CID 126471827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).