About 1-[6-[4-(trifluoromethyl)phenyl]spiro[4H-1,3-benzodioxine-2,4'-piperidine]-1'-yl]ethanone
1-[6-[4-(trifluoromethyl)phenyl]spiro[4H-1,3-benzodioxine-2,4'-piperidine]-1'-yl]ethanone (PubChem CID 126471895) has the molecular formula C21H20F3NO3
and a molecular weight of 391.39 g/mol. Its IUPAC name is 1-[6-[4-(trifluoromethyl)phenyl]spiro[4H-1,3-benzodioxine-2,4'-piperidine]-1'-yl]ethanone.
Molecular Properties
| Compound Name | 1-[6-[4-(trifluoromethyl)phenyl]spiro[4H-1,3-benzodioxine-2,4'-piperidine]-1'-yl]ethanone |
| PubChem CID | 126471895 |
| Molecular Formula | C21H20F3NO3 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 1-[6-[4-(trifluoromethyl)phenyl]spiro[4H-1,3-benzodioxine-2,4'-piperidine]-1'-yl]ethanone |
| SMILES | CC(=O)N1CCC2(CC1)OCc1cc(-c3ccc(C(F)(F)F)cc3)ccc1O2 |
| InChI | InChI=1S/C21H20F3NO3/c1-14(26)25-10-8-20(9-11-25)27-13-17-12-16(4-7-19(17)28-20)15-2-5-18(6-3-15)21(22,23)24/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | UFDLDSAYGRKAKB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[6-[4-(trifluoromethyl)phenyl]spiro[4H-1,3-benzodioxine-2,4'-piperidine]-1'-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-[4-(trifluoromethyl)phenyl]spiro[4H-1,3-benzodioxine-2,4'-piperidine]-1'-yl]ethanone?
The IUPAC name of 1-[6-[4-(trifluoromethyl)phenyl]spiro[4H-1,3-benzodioxine-2,4'-piperidine]-1'-yl]ethanone (CID 126471895) is 1-[6-[4-(trifluoromethyl)phenyl]spiro[4H-1,3-benzodioxine-2,4'-piperidine]-1'-yl]ethanone.
What is the SMILES notation for 1-[6-[4-(trifluoromethyl)phenyl]spiro[4H-1,3-benzodioxine-2,4'-piperidine]-1'-yl]ethanone?
The canonical SMILES for 1-[6-[4-(trifluoromethyl)phenyl]spiro[4H-1,3-benzodioxine-2,4'-piperidine]-1'-yl]ethanone is CC(=O)N1CCC2(CC1)OCc1cc(-c3ccc(C(F)(F)F)cc3)ccc1O2.
What is the InChIKey of 1-[6-[4-(trifluoromethyl)phenyl]spiro[4H-1,3-benzodioxine-2,4'-piperidine]-1'-yl]ethanone?
The InChIKey is UFDLDSAYGRKAKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20F3NO3/c1-14(26)25-10-8-20(9-11-25)27-13-17-12-16(4-7-19(17)28-20)15-2-5-18(6-3-15)21(22,23)24/h2-7,12H,8-11,13H2,1H3.
What are the key properties of 1-[6-[4-(trifluoromethyl)phenyl]spiro[4H-1,3-benzodioxine-2,4'-piperidine]-1'-yl]ethanone?
1-[6-[4-(trifluoromethyl)phenyl]spiro[4H-1,3-benzodioxine-2,4'-piperidine]-1'-yl]ethanone has a molecular weight of 391.39 g/mol, XLogP of 4.62, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-[4-(trifluoromethyl)phenyl]spiro[4H-1,3-benzodioxine-2,4'-piperidine]-1'-yl]ethanone is sourced from PubChem (CID 126471895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).