C18H16N2O6 — CID 126471940
methyl 3-[(2-methyl-6-nitro-3-oxo-1,4-benzoxazin-4-yl)methyl]benzoate (PubChem CID 126471940) has the molecular formula C18H16N2O6 and a molecular weight of 356.33 g/mol. Its IUPAC name is methyl 3-[(2-methyl-6-nitro-3-oxo-1,4-benzoxazin-4-yl)methyl]benzoate.
| Compound Name | methyl 3-[(2-methyl-6-nitro-3-oxo-1,4-benzoxazin-4-yl)methyl]benzoate |
|---|---|
| PubChem CID | 126471940 |
| Molecular Formula | C18H16N2O6 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | methyl 3-[(2-methyl-6-nitro-3-oxo-1,4-benzoxazin-4-yl)methyl]benzoate |
| SMILES | COC(=O)c1cccc(CN2C(=O)C(C)Oc3ccc([N+](=O)[O-])cc32)c1 |
| InChI | InChI=1S/C18H16N2O6/c1-11-17(21)19(10-12-4-3-5-13(8-12)18(22)25-2)15-9-14(20(23)24)6-7-16(15)26-11/h3-9,11H,10H2,1-2H3 |
| InChIKey | SGWWMIUUEHDJIS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|