About 5-[(E)-hex-1-enyl]-3-(3-methoxypropyl)-1H-imidazo[4,5-b]pyrazin-2-one
5-[(E)-hex-1-enyl]-3-(3-methoxypropyl)-1H-imidazo[4,5-b]pyrazin-2-one (PubChem CID 126472190) has the molecular formula C15H22N4O2
and a molecular weight of 290.37 g/mol. Its IUPAC name is 5-[(E)-hex-1-enyl]-3-(3-methoxypropyl)-1H-imidazo[4,5-b]pyrazin-2-one.
Molecular Properties
| Compound Name | 5-[(E)-hex-1-enyl]-3-(3-methoxypropyl)-1H-imidazo[4,5-b]pyrazin-2-one |
| PubChem CID | 126472190 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 5-[(E)-hex-1-enyl]-3-(3-methoxypropyl)-1H-imidazo[4,5-b]pyrazin-2-one |
| SMILES | CCCC/C=C/c1cnc2[nH]c(=O)n(CCCOC)c2n1 |
| InChI | InChI=1S/C15H22N4O2/c1-3-4-5-6-8-12-11-16-13-14(17-12)19(15(20)18-13)9-7-10-21-2/h6,8,11H,3-5,7,9-10H2,1-2H3,(H,16,18,20)/b8-6+ |
| InChIKey | ZVBRTMMYRCTKCE-SOFGYWHQSA-N |
| XLogP | 2.36 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[(E)-hex-1-enyl]-3-(3-methoxypropyl)-1H-imidazo[4,5-b]pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-hex-1-enyl]-3-(3-methoxypropyl)-1H-imidazo[4,5-b]pyrazin-2-one?
The IUPAC name of 5-[(E)-hex-1-enyl]-3-(3-methoxypropyl)-1H-imidazo[4,5-b]pyrazin-2-one (CID 126472190) is 5-[(E)-hex-1-enyl]-3-(3-methoxypropyl)-1H-imidazo[4,5-b]pyrazin-2-one.
What is the SMILES notation for 5-[(E)-hex-1-enyl]-3-(3-methoxypropyl)-1H-imidazo[4,5-b]pyrazin-2-one?
The canonical SMILES for 5-[(E)-hex-1-enyl]-3-(3-methoxypropyl)-1H-imidazo[4,5-b]pyrazin-2-one is CCCC/C=C/c1cnc2[nH]c(=O)n(CCCOC)c2n1.
What is the InChIKey of 5-[(E)-hex-1-enyl]-3-(3-methoxypropyl)-1H-imidazo[4,5-b]pyrazin-2-one?
The InChIKey is ZVBRTMMYRCTKCE-SOFGYWHQSA-N. The full InChI is InChI=1S/C15H22N4O2/c1-3-4-5-6-8-12-11-16-13-14(17-12)19(15(20)18-13)9-7-10-21-2/h6,8,11H,3-5,7,9-10H2,1-2H3,(H,16,18,20)/b8-6+.
What are the key properties of 5-[(E)-hex-1-enyl]-3-(3-methoxypropyl)-1H-imidazo[4,5-b]pyrazin-2-one?
5-[(E)-hex-1-enyl]-3-(3-methoxypropyl)-1H-imidazo[4,5-b]pyrazin-2-one has a molecular weight of 290.37 g/mol, XLogP of 2.36, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-hex-1-enyl]-3-(3-methoxypropyl)-1H-imidazo[4,5-b]pyrazin-2-one is sourced from PubChem (CID 126472190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).