C18H17F2NO2 — CID 126472457
6-(3,4-difluorophenyl)spiro[4H-1,3-benzodioxine-2,4'-piperidine] (PubChem CID 126472457) has the molecular formula C18H17F2NO2 and a molecular weight of 317.34 g/mol. Its IUPAC name is 6-(3,4-difluorophenyl)spiro[4H-1,3-benzodioxine-2,4'-piperidine].
| Compound Name | 6-(3,4-difluorophenyl)spiro[4H-1,3-benzodioxine-2,4'-piperidine] |
|---|---|
| PubChem CID | 126472457 |
| Molecular Formula | C18H17F2NO2 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 6-(3,4-difluorophenyl)spiro[4H-1,3-benzodioxine-2,4'-piperidine] |
| SMILES | Fc1ccc(-c2ccc3c(c2)COC2(CCNCC2)O3)cc1F |
| InChI | InChI=1S/C18H17F2NO2/c19-15-3-1-13(10-16(15)20)12-2-4-17-14(9-12)11-22-18(23-17)5-7-21-8-6-18/h1-4,9-10,21H,5-8,11H2 |
| InChIKey | CFMFRKSVGAQOSV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |