C20H25N3O — CID 126474045
4-(6-methylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-piperidine]-1'-yl)butanenitrile (PubChem CID 126474045) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 4-(6-methylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-piperidine]-1'-yl)butanenitrile.
| Compound Name | 4-(6-methylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-piperidine]-1'-yl)butanenitrile |
|---|---|
| PubChem CID | 126474045 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 4-(6-methylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-piperidine]-1'-yl)butanenitrile |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CCOC31CCN(CCCC#N)CC1 |
| InChI | InChI=1S/C20H25N3O/c1-15-4-5-18-17(14-15)16-6-13-24-20(19(16)22-18)7-11-23(12-8-20)10-3-2-9-21/h4-5,14,22H,2-3,6-8,10-13H2,1H3 |
| InChIKey | HFROQKHXRRABRF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|