C7H10F5NO — CID 12647417
N,N-diethyl-2,2,3,3,3-pentafluoropropanamide (PubChem CID 12647417) has the molecular formula C7H10F5NO and a molecular weight of 219.15 g/mol. Its IUPAC name is N,N-diethyl-2,2,3,3,3-pentafluoropropanamide.
| Compound Name | N,N-diethyl-2,2,3,3,3-pentafluoropropanamide |
|---|---|
| PubChem CID | 12647417 |
| Molecular Formula | C7H10F5NO |
| Molecular Weight | 219.15 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | N,N-diethyl-2,2,3,3,3-pentafluoropropanamide |
| SMILES | CCN(CC)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H10F5NO/c1-3-13(4-2)5(14)6(8,9)7(10,11)12/h3-4H2,1-2H3 |
| InChIKey | SXUIGIYXZNBEFG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.15 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|