About 6-(3-fluorophenyl)-1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine]
6-(3-fluorophenyl)-1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine] (PubChem CID 126474509) has the molecular formula C19H20FNO2
and a molecular weight of 313.37 g/mol. Its IUPAC name is 6-(3-fluorophenyl)-1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine].
Molecular Properties
| Compound Name | 6-(3-fluorophenyl)-1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine] |
| PubChem CID | 126474509 |
| Molecular Formula | C19H20FNO2 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 6-(3-fluorophenyl)-1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine] |
| SMILES | CN1CCC2(CC1)OCc1cc(-c3cccc(F)c3)ccc1O2 |
| InChI | InChI=1S/C19H20FNO2/c1-21-9-7-19(8-10-21)22-13-16-11-15(5-6-18(16)23-19)14-3-2-4-17(20)12-14/h2-6,11-12H,7-10,13H2,1H3 |
| InChIKey | QPLHVUKRVSJFHV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(3-fluorophenyl)-1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-fluorophenyl)-1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine]?
The IUPAC name of 6-(3-fluorophenyl)-1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine] (CID 126474509) is 6-(3-fluorophenyl)-1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine].
What is the SMILES notation for 6-(3-fluorophenyl)-1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine]?
The canonical SMILES for 6-(3-fluorophenyl)-1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine] is CN1CCC2(CC1)OCc1cc(-c3cccc(F)c3)ccc1O2.
What is the InChIKey of 6-(3-fluorophenyl)-1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine]?
The InChIKey is QPLHVUKRVSJFHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20FNO2/c1-21-9-7-19(8-10-21)22-13-16-11-15(5-6-18(16)23-19)14-3-2-4-17(20)12-14/h2-6,11-12H,7-10,13H2,1H3.
What are the key properties of 6-(3-fluorophenyl)-1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine]?
6-(3-fluorophenyl)-1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine] has a molecular weight of 313.37 g/mol, XLogP of 3.82, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-fluorophenyl)-1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine] is sourced from PubChem (CID 126474509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).