About 3-(1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)benzonitrile
3-(1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)benzonitrile (PubChem CID 126475085) has the molecular formula C20H20N2O2
and a molecular weight of 320.39 g/mol. Its IUPAC name is 3-(1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)benzonitrile.
Molecular Properties
| Compound Name | 3-(1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)benzonitrile |
| PubChem CID | 126475085 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 3-(1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)benzonitrile |
| SMILES | CN1CCC2(CC1)OCc1cc(-c3cccc(C#N)c3)ccc1O2 |
| InChI | InChI=1S/C20H20N2O2/c1-22-9-7-20(8-10-22)23-14-18-12-17(5-6-19(18)24-20)16-4-2-3-15(11-16)13-21/h2-6,11-12H,7-10,14H2,1H3 |
| InChIKey | QZVURKKUBBOSRO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)benzonitrile?
The IUPAC name of 3-(1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)benzonitrile (CID 126475085) is 3-(1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)benzonitrile.
What is the SMILES notation for 3-(1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)benzonitrile?
The canonical SMILES for 3-(1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)benzonitrile is CN1CCC2(CC1)OCc1cc(-c3cccc(C#N)c3)ccc1O2.
What is the InChIKey of 3-(1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)benzonitrile?
The InChIKey is QZVURKKUBBOSRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O2/c1-22-9-7-20(8-10-22)23-14-18-12-17(5-6-19(18)24-20)16-4-2-3-15(11-16)13-21/h2-6,11-12H,7-10,14H2,1H3.
What are the key properties of 3-(1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)benzonitrile?
3-(1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)benzonitrile has a molecular weight of 320.39 g/mol, XLogP of 3.56, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)benzonitrile is sourced from PubChem (CID 126475085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).