C19H18N4O2 — CID 126475364
(E)-3-[3-[8-(cyclopropylmethylamino)imidazo[1,2-a]pyrazin-5-yl]phenyl]prop-2-enoic acid (PubChem CID 126475364) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is (E)-3-[3-[8-(cyclopropylmethylamino)imidazo[1,2-a]pyrazin-5-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[8-(cyclopropylmethylamino)imidazo[1,2-a]pyrazin-5-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 126475364 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (E)-3-[3-[8-(cyclopropylmethylamino)imidazo[1,2-a]pyrazin-5-yl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc(-c2cnc(NCC3CC3)c3nccn23)c1 |
| InChI | InChI=1S/C19H18N4O2/c24-17(25)7-6-13-2-1-3-15(10-13)16-12-22-18(21-11-14-4-5-14)19-20-8-9-23(16)19/h1-3,6-10,12,14H,4-5,11H2,(H,21,22)(H,24,25)/b7-6+ |
| InChIKey | KHOFEEQBVLLYFK-VOTSOKGWSA-N |
| XLogP | 3.32 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|