About 6-(4-methoxyphenyl)-1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine]
6-(4-methoxyphenyl)-1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine] (PubChem CID 126475482) has the molecular formula C20H23NO3
and a molecular weight of 325.41 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine].
Molecular Properties
| Compound Name | 6-(4-methoxyphenyl)-1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine] |
| PubChem CID | 126475482 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 6-(4-methoxyphenyl)-1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine] |
| SMILES | COc1ccc(-c2ccc3c(c2)COC2(CCN(C)CC2)O3)cc1 |
| InChI | InChI=1S/C20H23NO3/c1-21-11-9-20(10-12-21)23-14-17-13-16(5-8-19(17)24-20)15-3-6-18(22-2)7-4-15/h3-8,13H,9-12,14H2,1-2H3 |
| InChIKey | YKASCECTCKGGCM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(4-methoxyphenyl)-1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-methoxyphenyl)-1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine]?
The IUPAC name of 6-(4-methoxyphenyl)-1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine] (CID 126475482) is 6-(4-methoxyphenyl)-1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine].
What is the SMILES notation for 6-(4-methoxyphenyl)-1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine]?
The canonical SMILES for 6-(4-methoxyphenyl)-1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine] is COc1ccc(-c2ccc3c(c2)COC2(CCN(C)CC2)O3)cc1.
What is the InChIKey of 6-(4-methoxyphenyl)-1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine]?
The InChIKey is YKASCECTCKGGCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO3/c1-21-11-9-20(10-12-21)23-14-17-13-16(5-8-19(17)24-20)15-3-6-18(22-2)7-4-15/h3-8,13H,9-12,14H2,1-2H3.
What are the key properties of 6-(4-methoxyphenyl)-1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine]?
6-(4-methoxyphenyl)-1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine] has a molecular weight of 325.41 g/mol, XLogP of 3.69, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-methoxyphenyl)-1'-methylspiro[4H-1,3-benzodioxine-2,4'-piperidine] is sourced from PubChem (CID 126475482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).