About N-[(4-fluorophenyl)methyl]-3-(furan-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine
N-[(4-fluorophenyl)methyl]-3-(furan-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 126475532) has the molecular formula C17H13FN4O
and a molecular weight of 308.32 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3-(furan-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine.
Molecular Properties
| Compound Name | N-[(4-fluorophenyl)methyl]-3-(furan-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine |
| PubChem CID | 126475532 |
| Molecular Formula | C17H13FN4O |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3-(furan-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Fc1ccc(CNc2ccnc3c(-c4ccoc4)cnn23)cc1 |
| InChI | InChI=1S/C17H13FN4O/c18-14-3-1-12(2-4-14)9-20-16-5-7-19-17-15(10-21-22(16)17)13-6-8-23-11-13/h1-8,10-11,20H,9H2 |
| InChIKey | WIWMCIPIXYPKBU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 55.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(4-fluorophenyl)methyl]-3-(furan-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-fluorophenyl)methyl]-3-(furan-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine?
The IUPAC name of N-[(4-fluorophenyl)methyl]-3-(furan-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine (CID 126475532) is N-[(4-fluorophenyl)methyl]-3-(furan-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine.
What is the SMILES notation for N-[(4-fluorophenyl)methyl]-3-(furan-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine?
The canonical SMILES for N-[(4-fluorophenyl)methyl]-3-(furan-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine is Fc1ccc(CNc2ccnc3c(-c4ccoc4)cnn23)cc1.
What is the InChIKey of N-[(4-fluorophenyl)methyl]-3-(furan-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine?
The InChIKey is WIWMCIPIXYPKBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13FN4O/c18-14-3-1-12(2-4-14)9-20-16-5-7-19-17-15(10-21-22(16)17)13-6-8-23-11-13/h1-8,10-11,20H,9H2.
What are the key properties of N-[(4-fluorophenyl)methyl]-3-(furan-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine?
N-[(4-fluorophenyl)methyl]-3-(furan-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine has a molecular weight of 308.32 g/mol, XLogP of 3.74, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-fluorophenyl)methyl]-3-(furan-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine is sourced from PubChem (CID 126475532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).