C19H16N4O2 — CID 126475662
5-(3-hydroxyphenyl)-3-[(1R)-1-phenylethyl]-1H-imidazo[4,5-b]pyrazin-2-one (PubChem CID 126475662) has the molecular formula C19H16N4O2 and a molecular weight of 332.36 g/mol. Its IUPAC name is 5-(3-hydroxyphenyl)-3-[(1R)-1-phenylethyl]-1H-imidazo[4,5-b]pyrazin-2-one.
| Compound Name | 5-(3-hydroxyphenyl)-3-[(1R)-1-phenylethyl]-1H-imidazo[4,5-b]pyrazin-2-one |
|---|---|
| PubChem CID | 126475662 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 5-(3-hydroxyphenyl)-3-[(1R)-1-phenylethyl]-1H-imidazo[4,5-b]pyrazin-2-one |
| SMILES | C[C@H](c1ccccc1)n1c(=O)[nH]c2ncc(-c3cccc(O)c3)nc21 |
| InChI | InChI=1S/C19H16N4O2/c1-12(13-6-3-2-4-7-13)23-18-17(22-19(23)25)20-11-16(21-18)14-8-5-9-15(24)10-14/h2-12,24H,1H3,(H,20,22,25)/t12-/m1/s1 |
| InChIKey | ISIRSMKZUQGYGA-GFCCVEGCSA-N |
| XLogP | 3.10 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |