About 4-methyl-4-(3-methylbutyl)-1,4-thiazinan-4-ium 1-oxide iodide
4-methyl-4-(3-methylbutyl)-1,4-thiazinan-4-ium 1-oxide iodide (PubChem CID 126476109) has the molecular formula C10H22INOS
and a molecular weight of 331.26 g/mol. Its IUPAC name is 4-methyl-4-(3-methylbutyl)-1,4-thiazinan-4-ium 1-oxide iodide.
Molecular Properties
| Compound Name | 4-methyl-4-(3-methylbutyl)-1,4-thiazinan-4-ium 1-oxide iodide |
| PubChem CID | 126476109 |
| Molecular Formula | C10H22INOS |
| Molecular Weight | 331.26 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 4-methyl-4-(3-methylbutyl)-1,4-thiazinan-4-ium 1-oxide iodide |
| SMILES | CC(C)CC[N+]1(C)CCS(=O)CC1.[I-] |
| InChI | InChI=1S/C10H22NOS.HI/c1-10(2)4-5-11(3)6-8-13(12)9-7-11;/h10H,4-9H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | LXTGKJXKMKLTHL-UHFFFAOYSA-M |
| XLogP | -1.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.26 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-4-(3-methylbutyl)-1,4-thiazinan-4-ium 1-oxide iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-4-(3-methylbutyl)-1,4-thiazinan-4-ium 1-oxide iodide?
The IUPAC name of 4-methyl-4-(3-methylbutyl)-1,4-thiazinan-4-ium 1-oxide iodide (CID 126476109) is 4-methyl-4-(3-methylbutyl)-1,4-thiazinan-4-ium 1-oxide iodide.
What is the SMILES notation for 4-methyl-4-(3-methylbutyl)-1,4-thiazinan-4-ium 1-oxide iodide?
The canonical SMILES for 4-methyl-4-(3-methylbutyl)-1,4-thiazinan-4-ium 1-oxide iodide is CC(C)CC[N+]1(C)CCS(=O)CC1.[I-].
What is the InChIKey of 4-methyl-4-(3-methylbutyl)-1,4-thiazinan-4-ium 1-oxide iodide?
The InChIKey is LXTGKJXKMKLTHL-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H22NOS.HI/c1-10(2)4-5-11(3)6-8-13(12)9-7-11;/h10H,4-9H2,1-3H3;1H/q+1;/p-1.
What are the key properties of 4-methyl-4-(3-methylbutyl)-1,4-thiazinan-4-ium 1-oxide iodide?
4-methyl-4-(3-methylbutyl)-1,4-thiazinan-4-ium 1-oxide iodide has a molecular weight of 331.26 g/mol, XLogP of -1.75, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-4-(3-methylbutyl)-1,4-thiazinan-4-ium 1-oxide iodide is sourced from PubChem (CID 126476109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).