C26H29IN2OS — CID 126476246
(2Z)-3-ethyl-2-[(1-ethyl-6-methoxyquinolin-1-ium-2-yl)methylidene]-6,7,8,9-tetrahydrobenzo[g][1,3]benzothiazole iodide (PubChem CID 126476246) has the molecular formula C26H29IN2OS and a molecular weight of 544.50 g/mol. Its IUPAC name is (2Z)-3-ethyl-2-[(1-ethyl-6-methoxyquinolin-1-ium-2-yl)methylidene]-6,7,8,9-tetrahydrobenzo[g][1,3]benzothiazole iodide.
| Compound Name | (2Z)-3-ethyl-2-[(1-ethyl-6-methoxyquinolin-1-ium-2-yl)methylidene]-6,7,8,9-tetrahydrobenzo[g][1,3]benzothiazole iodide |
|---|---|
| PubChem CID | 126476246 |
| Molecular Formula | C26H29IN2OS |
| Molecular Weight | 544.50 g/mol |
| Exact Mass | 544.10 |
| IUPAC Name | (2Z)-3-ethyl-2-[(1-ethyl-6-methoxyquinolin-1-ium-2-yl)methylidene]-6,7,8,9-tetrahydrobenzo[g][1,3]benzothiazole iodide |
| SMILES | CCN1/C(=C/c2ccc3cc(OC)ccc3[n+]2CC)Sc2c1ccc1c2CCCC1.[I-] |
| InChI | InChI=1S/C26H29N2OS.HI/c1-4-27-20(12-10-19-16-21(29-3)13-15-23(19)27)17-25-28(5-2)24-14-11-18-8-6-7-9-22(18)26(24)30-25;/h10-17H,4-9H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | FCXKFAOABZWYEO-UHFFFAOYSA-M |
| XLogP | 2.97 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|