About lithium 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]acetic acid
lithium 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]acetic acid (PubChem CID 126476298) has the molecular formula C7H7LiN3O5+
and a molecular weight of 220.09 g/mol. Its IUPAC name is lithium 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]acetic acid.
Molecular Properties
| Compound Name | lithium 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]acetic acid |
| PubChem CID | 126476298 |
| Molecular Formula | C7H7LiN3O5+ |
| Molecular Weight | 220.09 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | lithium 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1cc(=O)[nH]c(=O)[nH]1.[Li+] |
| InChI | InChI=1S/C7H7N3O5.Li/c11-4-1-3(9-7(15)10-4)6(14)8-2-5(12)13;/h1H,2H2,(H,8,14)(H,12,13)(H2,9,10,11,15);/q;+1 |
| InChIKey | APHQFZNOAOOGKR-UHFFFAOYSA-N |
| XLogP | -5.12 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.09 |
| LogP ≤ 5 | -5.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze lithium 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]acetic acid?
The IUPAC name of lithium 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]acetic acid (CID 126476298) is lithium 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]acetic acid.
What is the SMILES notation for lithium 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]acetic acid?
The canonical SMILES for lithium 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]acetic acid is O=C(O)CNC(=O)c1cc(=O)[nH]c(=O)[nH]1.[Li+].
What is the InChIKey of lithium 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]acetic acid?
The InChIKey is APHQFZNOAOOGKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O5.Li/c11-4-1-3(9-7(15)10-4)6(14)8-2-5(12)13;/h1H,2H2,(H,8,14)(H,12,13)(H2,9,10,11,15);/q;+1.
What are the key properties of lithium 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]acetic acid?
lithium 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]acetic acid has a molecular weight of 220.09 g/mol, XLogP of -5.12, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]acetic acid is sourced from PubChem (CID 126476298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).