C23H26FN5O — CID 126476312
6-amino-8-(4-fluorophenyl)-2-propan-2-yl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile;ethanol (PubChem CID 126476312) has the molecular formula C23H26FN5O and a molecular weight of 407.49 g/mol. Its IUPAC name is 6-amino-8-(4-fluorophenyl)-2-propan-2-yl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile;ethanol.
| Compound Name | 6-amino-8-(4-fluorophenyl)-2-propan-2-yl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile;ethanol |
|---|---|
| PubChem CID | 126476312 |
| Molecular Formula | C23H26FN5O |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 6-amino-8-(4-fluorophenyl)-2-propan-2-yl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile;ethanol |
| SMILES | CC(C)N1CC=C2C(C#N)=C(N)C(C#N)(C#N)C(c3ccc(F)cc3)C2C1.CCO |
| InChI | InChI=1S/C21H20FN5.C2H6O/c1-13(2)27-8-7-16-17(9-23)20(26)21(11-24,12-25)19(18(16)10-27)14-3-5-15(22)6-4-14;1-2-3/h3-7,13,18-19H,8,10,26H2,1-2H3;3H,2H2,1H3 |
| InChIKey | VBMIZJIXGBBBKZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|