About 1-tert-butyl-2,5-dimethylpiperidin-4-ol;hydrochloride
1-tert-butyl-2,5-dimethylpiperidin-4-ol;hydrochloride (PubChem CID 126476599) has the molecular formula C11H24ClNO
and a molecular weight of 221.77 g/mol. Its IUPAC name is 1-tert-butyl-2,5-dimethylpiperidin-4-ol;hydrochloride.
Molecular Properties
| Compound Name | 1-tert-butyl-2,5-dimethylpiperidin-4-ol;hydrochloride |
| PubChem CID | 126476599 |
| Molecular Formula | C11H24ClNO |
| Molecular Weight | 221.77 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 1-tert-butyl-2,5-dimethylpiperidin-4-ol;hydrochloride |
| SMILES | CC1CN(C(C)(C)C)C(C)CC1O.Cl |
| InChI | InChI=1S/C11H23NO.ClH/c1-8-7-12(11(3,4)5)9(2)6-10(8)13;/h8-10,13H,6-7H2,1-5H3;1H |
| InChIKey | LVFKLYVTBPNTJN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.77 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butyl-2,5-dimethylpiperidin-4-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-2,5-dimethylpiperidin-4-ol;hydrochloride?
The IUPAC name of 1-tert-butyl-2,5-dimethylpiperidin-4-ol;hydrochloride (CID 126476599) is 1-tert-butyl-2,5-dimethylpiperidin-4-ol;hydrochloride.
What is the SMILES notation for 1-tert-butyl-2,5-dimethylpiperidin-4-ol;hydrochloride?
The canonical SMILES for 1-tert-butyl-2,5-dimethylpiperidin-4-ol;hydrochloride is CC1CN(C(C)(C)C)C(C)CC1O.Cl.
What is the InChIKey of 1-tert-butyl-2,5-dimethylpiperidin-4-ol;hydrochloride?
The InChIKey is LVFKLYVTBPNTJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO.ClH/c1-8-7-12(11(3,4)5)9(2)6-10(8)13;/h8-10,13H,6-7H2,1-5H3;1H.
What are the key properties of 1-tert-butyl-2,5-dimethylpiperidin-4-ol;hydrochloride?
1-tert-butyl-2,5-dimethylpiperidin-4-ol;hydrochloride has a molecular weight of 221.77 g/mol, XLogP of 2.30, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-2,5-dimethylpiperidin-4-ol;hydrochloride is sourced from PubChem (CID 126476599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).