C24H48O6 — CID 126476615
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(2-octyldecoxy)oxane-3,4,5-triol (PubChem CID 126476615) has the molecular formula C24H48O6 and a molecular weight of 432.64 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(2-octyldecoxy)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(2-octyldecoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 126476615 |
| Molecular Formula | C24H48O6 |
| Molecular Weight | 432.64 g/mol |
| Exact Mass | 432.35 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(2-octyldecoxy)oxane-3,4,5-triol |
| SMILES | CCCCCCCCC(CCCCCCCC)CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H48O6/c1-3-5-7-9-11-13-15-19(16-14-12-10-8-6-4-2)18-29-24-23(28)22(27)21(26)20(17-25)30-24/h19-28H,3-18H2,1-2H3/t20-,21-,22+,23-,24-/m1/s1 |
| InChIKey | UFVDTFGZVCQFCL-GNADVCDUSA-N |
| XLogP | 3.92 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.64 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|