C26H35NO9 — CID 126476640
2,6-bis(2,5-dimethoxyphenyl)-3,4,5-trimethylpiperidin-4-ol;oxalic acid (PubChem CID 126476640) has the molecular formula C26H35NO9 and a molecular weight of 505.56 g/mol. Its IUPAC name is 2,6-bis(2,5-dimethoxyphenyl)-3,4,5-trimethylpiperidin-4-ol;oxalic acid.
| Compound Name | 2,6-bis(2,5-dimethoxyphenyl)-3,4,5-trimethylpiperidin-4-ol;oxalic acid |
|---|---|
| PubChem CID | 126476640 |
| Molecular Formula | C26H35NO9 |
| Molecular Weight | 505.56 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | 2,6-bis(2,5-dimethoxyphenyl)-3,4,5-trimethylpiperidin-4-ol;oxalic acid |
| SMILES | COc1ccc(OC)c(C2NC(c3cc(OC)ccc3OC)C(C)C(C)(O)C2C)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H33NO5.C2H2O4/c1-14-22(18-12-16(27-4)8-10-20(18)29-6)25-23(15(2)24(14,3)26)19-13-17(28-5)9-11-21(19)30-7;3-1(4)2(5)6/h8-15,22-23,25-26H,1-7H3;(H,3,4)(H,5,6) |
| InChIKey | YLJVLLNWSRUGGR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 143.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.56 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|