About (4-methoxy-2,6-dimethylpyridin-1-ium-1-yl) N,N-diphenylcarbamate;tetraphenylboranuide
(4-methoxy-2,6-dimethylpyridin-1-ium-1-yl) N,N-diphenylcarbamate;tetraphenylboranuide (PubChem CID 126476762) has the molecular formula C45H41BN2O3
and a molecular weight of 668.65 g/mol. Its IUPAC name is (4-methoxy-2,6-dimethylpyridin-1-ium-1-yl) N,N-diphenylcarbamate;tetraphenylboranuide.
Molecular Properties
| Compound Name | (4-methoxy-2,6-dimethylpyridin-1-ium-1-yl) N,N-diphenylcarbamate;tetraphenylboranuide |
| PubChem CID | 126476762 |
| Molecular Formula | C45H41BN2O3 |
| Molecular Weight | 668.65 g/mol |
| Exact Mass | 668.32 |
| IUPAC Name | (4-methoxy-2,6-dimethylpyridin-1-ium-1-yl) N,N-diphenylcarbamate;tetraphenylboranuide |
| SMILES | COc1cc(C)[n+](OC(=O)N(c2ccccc2)c2ccccc2)c(C)c1.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.C21H21N2O3/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-16-14-20(25-3)15-17(2)23(16)26-21(24)22(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h1-20H;4-15H,1-3H3/q-1;+1 |
| InChIKey | WEKNXYFEPCOAJE-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 42.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 668.65 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxy-2,6-dimethylpyridin-1-ium-1-yl) N,N-diphenylcarbamate;tetraphenylboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxy-2,6-dimethylpyridin-1-ium-1-yl) N,N-diphenylcarbamate;tetraphenylboranuide?
The IUPAC name of (4-methoxy-2,6-dimethylpyridin-1-ium-1-yl) N,N-diphenylcarbamate;tetraphenylboranuide (CID 126476762) is (4-methoxy-2,6-dimethylpyridin-1-ium-1-yl) N,N-diphenylcarbamate;tetraphenylboranuide.
What is the SMILES notation for (4-methoxy-2,6-dimethylpyridin-1-ium-1-yl) N,N-diphenylcarbamate;tetraphenylboranuide?
The canonical SMILES for (4-methoxy-2,6-dimethylpyridin-1-ium-1-yl) N,N-diphenylcarbamate;tetraphenylboranuide is COc1cc(C)[n+](OC(=O)N(c2ccccc2)c2ccccc2)c(C)c1.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of (4-methoxy-2,6-dimethylpyridin-1-ium-1-yl) N,N-diphenylcarbamate;tetraphenylboranuide?
The InChIKey is WEKNXYFEPCOAJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20B.C21H21N2O3/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-16-14-20(25-3)15-17(2)23(16)26-21(24)22(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h1-20H;4-15H,1-3H3/q-1;+1.
What are the key properties of (4-methoxy-2,6-dimethylpyridin-1-ium-1-yl) N,N-diphenylcarbamate;tetraphenylboranuide?
(4-methoxy-2,6-dimethylpyridin-1-ium-1-yl) N,N-diphenylcarbamate;tetraphenylboranuide has a molecular weight of 668.65 g/mol, XLogP of 7.05, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxy-2,6-dimethylpyridin-1-ium-1-yl) N,N-diphenylcarbamate;tetraphenylboranuide is sourced from PubChem (CID 126476762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).