About 6-amino-1,3-dimethyl-5-[2-(propan-2-ylamino)acetyl]pyrimidine-2,4-dione;hydrochloride
6-amino-1,3-dimethyl-5-[2-(propan-2-ylamino)acetyl]pyrimidine-2,4-dione;hydrochloride (PubChem CID 126477197) has the molecular formula C11H19ClN4O3
and a molecular weight of 290.75 g/mol. Its IUPAC name is 6-amino-1,3-dimethyl-5-[2-(propan-2-ylamino)acetyl]pyrimidine-2,4-dione;hydrochloride.
Molecular Properties
| Compound Name | 6-amino-1,3-dimethyl-5-[2-(propan-2-ylamino)acetyl]pyrimidine-2,4-dione;hydrochloride |
| PubChem CID | 126477197 |
| Molecular Formula | C11H19ClN4O3 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 6-amino-1,3-dimethyl-5-[2-(propan-2-ylamino)acetyl]pyrimidine-2,4-dione;hydrochloride |
| SMILES | CC(C)NCC(=O)c1c(N)n(C)c(=O)n(C)c1=O.Cl |
| InChI | InChI=1S/C11H18N4O3.ClH/c1-6(2)13-5-7(16)8-9(12)14(3)11(18)15(4)10(8)17;/h6,13H,5,12H2,1-4H3;1H |
| InChIKey | LOGCUALKUKLEEF-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-amino-1,3-dimethyl-5-[2-(propan-2-ylamino)acetyl]pyrimidine-2,4-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1,3-dimethyl-5-[2-(propan-2-ylamino)acetyl]pyrimidine-2,4-dione;hydrochloride?
The IUPAC name of 6-amino-1,3-dimethyl-5-[2-(propan-2-ylamino)acetyl]pyrimidine-2,4-dione;hydrochloride (CID 126477197) is 6-amino-1,3-dimethyl-5-[2-(propan-2-ylamino)acetyl]pyrimidine-2,4-dione;hydrochloride.
What is the SMILES notation for 6-amino-1,3-dimethyl-5-[2-(propan-2-ylamino)acetyl]pyrimidine-2,4-dione;hydrochloride?
The canonical SMILES for 6-amino-1,3-dimethyl-5-[2-(propan-2-ylamino)acetyl]pyrimidine-2,4-dione;hydrochloride is CC(C)NCC(=O)c1c(N)n(C)c(=O)n(C)c1=O.Cl.
What is the InChIKey of 6-amino-1,3-dimethyl-5-[2-(propan-2-ylamino)acetyl]pyrimidine-2,4-dione;hydrochloride?
The InChIKey is LOGCUALKUKLEEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O3.ClH/c1-6(2)13-5-7(16)8-9(12)14(3)11(18)15(4)10(8)17;/h6,13H,5,12H2,1-4H3;1H.
What are the key properties of 6-amino-1,3-dimethyl-5-[2-(propan-2-ylamino)acetyl]pyrimidine-2,4-dione;hydrochloride?
6-amino-1,3-dimethyl-5-[2-(propan-2-ylamino)acetyl]pyrimidine-2,4-dione;hydrochloride has a molecular weight of 290.75 g/mol, XLogP of -0.73, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1,3-dimethyl-5-[2-(propan-2-ylamino)acetyl]pyrimidine-2,4-dione;hydrochloride is sourced from PubChem (CID 126477197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).