C17H20N2O8S2 — CID 126477286
1-methylsulfonyl-4-naphthalen-2-ylsulfonylpiperazine;oxalic acid (PubChem CID 126477286) has the molecular formula C17H20N2O8S2 and a molecular weight of 444.49 g/mol. Its IUPAC name is 1-methylsulfonyl-4-naphthalen-2-ylsulfonylpiperazine;oxalic acid.
| Compound Name | 1-methylsulfonyl-4-naphthalen-2-ylsulfonylpiperazine;oxalic acid |
|---|---|
| PubChem CID | 126477286 |
| Molecular Formula | C17H20N2O8S2 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 1-methylsulfonyl-4-naphthalen-2-ylsulfonylpiperazine;oxalic acid |
| SMILES | CS(=O)(=O)N1CCN(S(=O)(=O)c2ccc3ccccc3c2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H18N2O4S2.C2H2O4/c1-22(18,19)16-8-10-17(11-9-16)23(20,21)15-7-6-13-4-2-3-5-14(13)12-15;3-1(4)2(5)6/h2-7,12H,8-11H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | PDKIBJQVQGSYLI-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 149.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|