C20H21ClN2O8S — CID 126477379
(4-chlorophenyl)-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methanone;oxalic acid (PubChem CID 126477379) has the molecular formula C20H21ClN2O8S and a molecular weight of 484.91 g/mol. Its IUPAC name is (4-chlorophenyl)-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methanone;oxalic acid.
| Compound Name | (4-chlorophenyl)-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methanone;oxalic acid |
|---|---|
| PubChem CID | 126477379 |
| Molecular Formula | C20H21ClN2O8S |
| Molecular Weight | 484.91 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | (4-chlorophenyl)-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methanone;oxalic acid |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(=O)c3ccc(Cl)cc3)CC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H19ClN2O4S.C2H2O4/c1-25-16-6-8-17(9-7-16)26(23,24)21-12-10-20(11-13-21)18(22)14-2-4-15(19)5-3-14;3-1(4)2(5)6/h2-9H,10-13H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | BWNSPHUSBVJOLJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 141.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.91 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|