C24H24Cl2N4O5 — CID 126477419
6-amino-4-(2,4-dichlorophenyl)-3-(3,4,5-trimethoxyphenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile;ethanol (PubChem CID 126477419) has the molecular formula C24H24Cl2N4O5 and a molecular weight of 519.39 g/mol. Its IUPAC name is 6-amino-4-(2,4-dichlorophenyl)-3-(3,4,5-trimethoxyphenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile;ethanol.
| Compound Name | 6-amino-4-(2,4-dichlorophenyl)-3-(3,4,5-trimethoxyphenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile;ethanol |
|---|---|
| PubChem CID | 126477419 |
| Molecular Formula | C24H24Cl2N4O5 |
| Molecular Weight | 519.39 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | 6-amino-4-(2,4-dichlorophenyl)-3-(3,4,5-trimethoxyphenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile;ethanol |
| SMILES | CCO.COc1cc(-c2[nH]nc3c2C(c2ccc(Cl)cc2Cl)C(C#N)=C(N)O3)cc(OC)c1OC |
| InChI | InChI=1S/C22H18Cl2N4O4.C2H6O/c1-29-15-6-10(7-16(30-2)20(15)31-3)19-18-17(12-5-4-11(23)8-14(12)24)13(9-25)21(26)32-22(18)28-27-19;1-2-3/h4-8,17H,26H2,1-3H3,(H,27,28);3H,2H2,1H3 |
| InChIKey | PTJXVSUVHOIBPF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.39 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |