About 4-[3-(2,6-dichlorophenyl)-4-methylidene-1,2-oxazol-5-yl]morpholine
4-[3-(2,6-dichlorophenyl)-4-methylidene-1,2-oxazol-5-yl]morpholine (PubChem CID 12647744) has the molecular formula C14H14Cl2N2O2
and a molecular weight of 313.18 g/mol. Its IUPAC name is 4-[3-(2,6-dichlorophenyl)-4-methylidene-1,2-oxazol-5-yl]morpholine.
Molecular Properties
| Compound Name | 4-[3-(2,6-dichlorophenyl)-4-methylidene-1,2-oxazol-5-yl]morpholine |
| PubChem CID | 12647744 |
| Molecular Formula | C14H14Cl2N2O2 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 4-[3-(2,6-dichlorophenyl)-4-methylidene-1,2-oxazol-5-yl]morpholine |
| SMILES | C=C1C(c2c(Cl)cccc2Cl)=NOC1N1CCOCC1 |
| InChI | InChI=1S/C14H14Cl2N2O2/c1-9-13(12-10(15)3-2-4-11(12)16)17-20-14(9)18-5-7-19-8-6-18/h2-4,14H,1,5-8H2 |
| InChIKey | OOOJKAKIPRQONK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[3-(2,6-dichlorophenyl)-4-methylidene-1,2-oxazol-5-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(2,6-dichlorophenyl)-4-methylidene-1,2-oxazol-5-yl]morpholine?
The IUPAC name of 4-[3-(2,6-dichlorophenyl)-4-methylidene-1,2-oxazol-5-yl]morpholine (CID 12647744) is 4-[3-(2,6-dichlorophenyl)-4-methylidene-1,2-oxazol-5-yl]morpholine.
What is the SMILES notation for 4-[3-(2,6-dichlorophenyl)-4-methylidene-1,2-oxazol-5-yl]morpholine?
The canonical SMILES for 4-[3-(2,6-dichlorophenyl)-4-methylidene-1,2-oxazol-5-yl]morpholine is C=C1C(c2c(Cl)cccc2Cl)=NOC1N1CCOCC1.
What is the InChIKey of 4-[3-(2,6-dichlorophenyl)-4-methylidene-1,2-oxazol-5-yl]morpholine?
The InChIKey is OOOJKAKIPRQONK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14Cl2N2O2/c1-9-13(12-10(15)3-2-4-11(12)16)17-20-14(9)18-5-7-19-8-6-18/h2-4,14H,1,5-8H2.
What are the key properties of 4-[3-(2,6-dichlorophenyl)-4-methylidene-1,2-oxazol-5-yl]morpholine?
4-[3-(2,6-dichlorophenyl)-4-methylidene-1,2-oxazol-5-yl]morpholine has a molecular weight of 313.18 g/mol, XLogP of 2.94, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(2,6-dichlorophenyl)-4-methylidene-1,2-oxazol-5-yl]morpholine is sourced from PubChem (CID 12647744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).