C15H19N3O5 — CID 126477711
2-amino-N-(2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),8-trien-8-yl)acetamide;oxalic acid (PubChem CID 126477711) has the molecular formula C15H19N3O5 and a molecular weight of 321.33 g/mol. Its IUPAC name is 2-amino-N-(2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),8-trien-8-yl)acetamide;oxalic acid.
| Compound Name | 2-amino-N-(2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),8-trien-8-yl)acetamide;oxalic acid |
|---|---|
| PubChem CID | 126477711 |
| Molecular Formula | C15H19N3O5 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 2-amino-N-(2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),8-trien-8-yl)acetamide;oxalic acid |
| SMILES | NCC(=O)Nc1c2c(nc3c1CCC3)CCC2.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H17N3O.C2H2O4/c14-7-12(17)16-13-8-3-1-5-10(8)15-11-6-2-4-9(11)13;3-1(4)2(5)6/h1-7,14H2,(H,15,16,17);(H,3,4)(H,5,6) |
| InChIKey | UBDFXJHNWJOUEL-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 142.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|