About 4-fluoro-2,6-dimethoxy-5-methylpyrimidine
4-fluoro-2,6-dimethoxy-5-methylpyrimidine (PubChem CID 126478348) has the molecular formula C7H9FN2O2
and a molecular weight of 172.16 g/mol. Its IUPAC name is 4-fluoro-2,6-dimethoxy-5-methylpyrimidine.
Molecular Properties
| Compound Name | 4-fluoro-2,6-dimethoxy-5-methylpyrimidine |
| PubChem CID | 126478348 |
| Molecular Formula | C7H9FN2O2 |
| Molecular Weight | 172.16 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 4-fluoro-2,6-dimethoxy-5-methylpyrimidine |
| SMILES | COc1nc(F)c(C)c(OC)n1 |
| InChI | InChI=1S/C7H9FN2O2/c1-4-5(8)9-7(12-3)10-6(4)11-2/h1-3H3 |
| InChIKey | BNBHGVIEJRPIRI-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.16 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-fluoro-2,6-dimethoxy-5-methylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-2,6-dimethoxy-5-methylpyrimidine?
The IUPAC name of 4-fluoro-2,6-dimethoxy-5-methylpyrimidine (CID 126478348) is 4-fluoro-2,6-dimethoxy-5-methylpyrimidine.
What is the SMILES notation for 4-fluoro-2,6-dimethoxy-5-methylpyrimidine?
The canonical SMILES for 4-fluoro-2,6-dimethoxy-5-methylpyrimidine is COc1nc(F)c(C)c(OC)n1.
What is the InChIKey of 4-fluoro-2,6-dimethoxy-5-methylpyrimidine?
The InChIKey is BNBHGVIEJRPIRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9FN2O2/c1-4-5(8)9-7(12-3)10-6(4)11-2/h1-3H3.
What are the key properties of 4-fluoro-2,6-dimethoxy-5-methylpyrimidine?
4-fluoro-2,6-dimethoxy-5-methylpyrimidine has a molecular weight of 172.16 g/mol, XLogP of 0.94, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2,6-dimethoxy-5-methylpyrimidine is sourced from PubChem (CID 126478348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).