About sodium 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]butanoic acid
sodium 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]butanoic acid (PubChem CID 126478514) has the molecular formula C9H11N3NaO5+
and a molecular weight of 264.19 g/mol. Its IUPAC name is sodium 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]butanoic acid.
Molecular Properties
| Compound Name | sodium 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]butanoic acid |
| PubChem CID | 126478514 |
| Molecular Formula | C9H11N3NaO5+ |
| Molecular Weight | 264.19 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | sodium 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)c1cc(=O)[nH]c(=O)[nH]1.[Na+] |
| InChI | InChI=1S/C9H11N3O5.Na/c13-6-4-5(11-9(17)12-6)8(16)10-3-1-2-7(14)15;/h4H,1-3H2,(H,10,16)(H,14,15)(H2,11,12,13,17);/q;+1 |
| InChIKey | BFANPSDSFPBWCT-UHFFFAOYSA-N |
| XLogP | -4.34 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.19 |
| LogP ≤ 5 | -4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]butanoic acid?
The IUPAC name of sodium 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]butanoic acid (CID 126478514) is sodium 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]butanoic acid.
What is the SMILES notation for sodium 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]butanoic acid?
The canonical SMILES for sodium 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]butanoic acid is O=C(O)CCCNC(=O)c1cc(=O)[nH]c(=O)[nH]1.[Na+].
What is the InChIKey of sodium 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]butanoic acid?
The InChIKey is BFANPSDSFPBWCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O5.Na/c13-6-4-5(11-9(17)12-6)8(16)10-3-1-2-7(14)15;/h4H,1-3H2,(H,10,16)(H,14,15)(H2,11,12,13,17);/q;+1.
What are the key properties of sodium 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]butanoic acid?
sodium 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]butanoic acid has a molecular weight of 264.19 g/mol, XLogP of -4.34, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]butanoic acid is sourced from PubChem (CID 126478514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).