C20H29N3O3S — CID 126478575
8-ethoxy-N-[3-(4-methylpiperidin-1-yl)propyl]quinoline-5-sulfonamide (PubChem CID 126478575) has the molecular formula C20H29N3O3S and a molecular weight of 391.54 g/mol. Its IUPAC name is 8-ethoxy-N-[3-(4-methylpiperidin-1-yl)propyl]quinoline-5-sulfonamide.
| Compound Name | 8-ethoxy-N-[3-(4-methylpiperidin-1-yl)propyl]quinoline-5-sulfonamide |
|---|---|
| PubChem CID | 126478575 |
| Molecular Formula | C20H29N3O3S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 8-ethoxy-N-[3-(4-methylpiperidin-1-yl)propyl]quinoline-5-sulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCCCN2CCC(C)CC2)c2cccnc12 |
| InChI | InChI=1S/C20H29N3O3S/c1-3-26-18-7-8-19(17-6-4-11-21-20(17)18)27(24,25)22-12-5-13-23-14-9-16(2)10-15-23/h4,6-8,11,16,22H,3,5,9-10,12-15H2,1-2H3 |
| InChIKey | FDCNFSXSOLPGAW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|