C15H18N2O2 — CID 126478886
6-(2,3-dimethylcyclohexyl)pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 126478886) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 6-(2,3-dimethylcyclohexyl)pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-(2,3-dimethylcyclohexyl)pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 126478886 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 6-(2,3-dimethylcyclohexyl)pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | CC1CCCC(N2C(=O)c3cccnc3C2=O)C1C |
| InChI | InChI=1S/C15H18N2O2/c1-9-5-3-7-12(10(9)2)17-14(18)11-6-4-8-16-13(11)15(17)19/h4,6,8-10,12H,3,5,7H2,1-2H3 |
| InChIKey | FQTHZBGJBHGYQT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|