About N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)benzenesulfonamide
N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)benzenesulfonamide (PubChem CID 1264790) has the molecular formula C14H11N3O4S
and a molecular weight of 317.33 g/mol. Its IUPAC name is N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)benzenesulfonamide |
| PubChem CID | 1264790 |
| Molecular Formula | C14H11N3O4S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)benzenesulfonamide |
| SMILES | O=c1[nH][nH]c(=O)c2c(NS(=O)(=O)c3ccccc3)cccc12 |
| InChI | InChI=1S/C14H11N3O4S/c18-13-10-7-4-8-11(12(10)14(19)16-15-13)17-22(20,21)9-5-2-1-3-6-9/h1-8,17H,(H,15,18)(H,16,19) |
| InChIKey | RGFZMJMCTDBGBG-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)benzenesulfonamide?
The IUPAC name of N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)benzenesulfonamide (CID 1264790) is N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)benzenesulfonamide.
What is the SMILES notation for N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)benzenesulfonamide?
The canonical SMILES for N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)benzenesulfonamide is O=c1[nH][nH]c(=O)c2c(NS(=O)(=O)c3ccccc3)cccc12.
What is the InChIKey of N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)benzenesulfonamide?
The InChIKey is RGFZMJMCTDBGBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O4S/c18-13-10-7-4-8-11(12(10)14(19)16-15-13)17-22(20,21)9-5-2-1-3-6-9/h1-8,17H,(H,15,18)(H,16,19).
What are the key properties of N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)benzenesulfonamide?
N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)benzenesulfonamide has a molecular weight of 317.33 g/mol, XLogP of 1.02, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)benzenesulfonamide is sourced from PubChem (CID 1264790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).