C25H30N4O2S3 — CID 126479122
N,N-diethylethanamine;6-(4-ethoxyphenyl)-3-phenyl-2,5-bis(sulfanylidene)-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one (PubChem CID 126479122) has the molecular formula C25H30N4O2S3 and a molecular weight of 514.74 g/mol. Its IUPAC name is N,N-diethylethanamine;6-(4-ethoxyphenyl)-3-phenyl-2,5-bis(sulfanylidene)-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one.
| Compound Name | N,N-diethylethanamine;6-(4-ethoxyphenyl)-3-phenyl-2,5-bis(sulfanylidene)-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 126479122 |
| Molecular Formula | C25H30N4O2S3 |
| Molecular Weight | 514.74 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | N,N-diethylethanamine;6-(4-ethoxyphenyl)-3-phenyl-2,5-bis(sulfanylidene)-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
| SMILES | CCN(CC)CC.CCOc1ccc(-n2c(=S)[nH]c3c(sc(=S)n3-c3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C19H15N3O2S3.C6H15N/c1-2-24-14-10-8-13(9-11-14)22-17(23)15-16(20-18(22)25)21(19(26)27-15)12-6-4-3-5-7-12;1-4-7(5-2)6-3/h3-11H,2H2,1H3,(H,20,25);4-6H2,1-3H3 |
| InChIKey | HEQCMSNYQVXJDP-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 55.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.74 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|