C19H17N3OS — CID 126479815
2-(2-pyridin-4-yl-4-thiophen-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl)phenol (PubChem CID 126479815) has the molecular formula C19H17N3OS and a molecular weight of 335.43 g/mol. Its IUPAC name is 2-(2-pyridin-4-yl-4-thiophen-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl)phenol.
| Compound Name | 2-(2-pyridin-4-yl-4-thiophen-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl)phenol |
|---|---|
| PubChem CID | 126479815 |
| Molecular Formula | C19H17N3OS |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 2-(2-pyridin-4-yl-4-thiophen-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl)phenol |
| SMILES | Oc1ccccc1C1CC(c2cccs2)=NC(c2ccncc2)N1 |
| InChI | InChI=1S/C19H17N3OS/c23-17-5-2-1-4-14(17)15-12-16(18-6-3-11-24-18)22-19(21-15)13-7-9-20-10-8-13/h1-11,15,19,21,23H,12H2 |
| InChIKey | HSAATHIGCKEIGP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|