About 1-chloroethylbenzene
1-chloroethylbenzene (PubChem CID 12648) has the molecular formula C8H9Cl
and a molecular weight of 140.61 g/mol. Its IUPAC name is 1-chloroethylbenzene.
Molecular Properties
| Compound Name | 1-chloroethylbenzene |
| PubChem CID | 12648 |
| Molecular Formula | C8H9Cl |
| Molecular Weight | 140.61 g/mol |
| Exact Mass | 140.04 |
| IUPAC Name | 1-chloroethylbenzene |
| SMILES | CC(Cl)c1ccccc1 |
| InChI | InChI=1S/C8H9Cl/c1-7(9)8-5-3-2-4-6-8/h2-7H,1H3 |
| InChIKey | GTLWADFFABIGAE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.61 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloroethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloroethylbenzene?
The IUPAC name of 1-chloroethylbenzene (CID 12648) is 1-chloroethylbenzene.
What is the SMILES notation for 1-chloroethylbenzene?
The canonical SMILES for 1-chloroethylbenzene is CC(Cl)c1ccccc1.
What is the InChIKey of 1-chloroethylbenzene?
The InChIKey is GTLWADFFABIGAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9Cl/c1-7(9)8-5-3-2-4-6-8/h2-7H,1H3.
What are the key properties of 1-chloroethylbenzene?
1-chloroethylbenzene has a molecular weight of 140.61 g/mol, XLogP of 2.99, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloroethylbenzene is sourced from PubChem (CID 12648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).