About 4-[2,5-bis[4-(2-piperidin-1-ylethyl)piperazine-1-carbonyl]anilino]benzoic acid
4-[2,5-bis[4-(2-piperidin-1-ylethyl)piperazine-1-carbonyl]anilino]benzoic acid (PubChem CID 126480579) has the molecular formula C37H53N7O4
and a molecular weight of 659.88 g/mol. Its IUPAC name is 4-[2,5-bis[4-(2-piperidin-1-ylethyl)piperazine-1-carbonyl]anilino]benzoic acid.
Molecular Properties
| Compound Name | 4-[2,5-bis[4-(2-piperidin-1-ylethyl)piperazine-1-carbonyl]anilino]benzoic acid |
| PubChem CID | 126480579 |
| Molecular Formula | C37H53N7O4 |
| Molecular Weight | 659.88 g/mol |
| Exact Mass | 659.42 |
| IUPAC Name | 4-[2,5-bis[4-(2-piperidin-1-ylethyl)piperazine-1-carbonyl]anilino]benzoic acid |
| SMILES | O=C(O)c1ccc(Nc2cc(C(=O)N3CCN(CCN4CCCCC4)CC3)ccc2C(=O)N2CCN(CCN3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C37H53N7O4/c45-35(43-25-21-41(22-26-43)19-17-39-13-3-1-4-14-39)31-9-12-33(34(29-31)38-32-10-7-30(8-11-32)37(47)48)36(46)44-27-23-42(24-28-44)20-18-40-15-5-2-6-16-40/h7-12,29,38H,1-6,13-28H2,(H,47,48) |
| InChIKey | GWLQITPBTGICNS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 659.88 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-[2,5-bis[4-(2-piperidin-1-ylethyl)piperazine-1-carbonyl]anilino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,5-bis[4-(2-piperidin-1-ylethyl)piperazine-1-carbonyl]anilino]benzoic acid?
The IUPAC name of 4-[2,5-bis[4-(2-piperidin-1-ylethyl)piperazine-1-carbonyl]anilino]benzoic acid (CID 126480579) is 4-[2,5-bis[4-(2-piperidin-1-ylethyl)piperazine-1-carbonyl]anilino]benzoic acid.
What is the SMILES notation for 4-[2,5-bis[4-(2-piperidin-1-ylethyl)piperazine-1-carbonyl]anilino]benzoic acid?
The canonical SMILES for 4-[2,5-bis[4-(2-piperidin-1-ylethyl)piperazine-1-carbonyl]anilino]benzoic acid is O=C(O)c1ccc(Nc2cc(C(=O)N3CCN(CCN4CCCCC4)CC3)ccc2C(=O)N2CCN(CCN3CCCCC3)CC2)cc1.
What is the InChIKey of 4-[2,5-bis[4-(2-piperidin-1-ylethyl)piperazine-1-carbonyl]anilino]benzoic acid?
The InChIKey is GWLQITPBTGICNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H53N7O4/c45-35(43-25-21-41(22-26-43)19-17-39-13-3-1-4-14-39)31-9-12-33(34(29-31)38-32-10-7-30(8-11-32)37(47)48)36(46)44-27-23-42(24-28-44)20-18-40-15-5-2-6-16-40/h7-12,29,38H,1-6,13-28H2,(H,47,48).
What are the key properties of 4-[2,5-bis[4-(2-piperidin-1-ylethyl)piperazine-1-carbonyl]anilino]benzoic acid?
4-[2,5-bis[4-(2-piperidin-1-ylethyl)piperazine-1-carbonyl]anilino]benzoic acid has a molecular weight of 659.88 g/mol, XLogP of 3.62, 11 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,5-bis[4-(2-piperidin-1-ylethyl)piperazine-1-carbonyl]anilino]benzoic acid is sourced from PubChem (CID 126480579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).