About 1-ethyl-4,4-difluoro-N-methylsulfonylpyrrolidine-2-carboxamide
1-ethyl-4,4-difluoro-N-methylsulfonylpyrrolidine-2-carboxamide (PubChem CID 126480634) has the molecular formula C8H14F2N2O3S
and a molecular weight of 256.27 g/mol. Its IUPAC name is 1-ethyl-4,4-difluoro-N-methylsulfonylpyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | 1-ethyl-4,4-difluoro-N-methylsulfonylpyrrolidine-2-carboxamide |
| PubChem CID | 126480634 |
| Molecular Formula | C8H14F2N2O3S |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 1-ethyl-4,4-difluoro-N-methylsulfonylpyrrolidine-2-carboxamide |
| SMILES | CCN1CC(F)(F)CC1C(=O)NS(C)(=O)=O |
| InChI | InChI=1S/C8H14F2N2O3S/c1-3-12-5-8(9,10)4-6(12)7(13)11-16(2,14)15/h6H,3-5H2,1-2H3,(H,11,13) |
| InChIKey | MKXBXKRRLLOQOM-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethyl-4,4-difluoro-N-methylsulfonylpyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4,4-difluoro-N-methylsulfonylpyrrolidine-2-carboxamide?
The IUPAC name of 1-ethyl-4,4-difluoro-N-methylsulfonylpyrrolidine-2-carboxamide (CID 126480634) is 1-ethyl-4,4-difluoro-N-methylsulfonylpyrrolidine-2-carboxamide.
What is the SMILES notation for 1-ethyl-4,4-difluoro-N-methylsulfonylpyrrolidine-2-carboxamide?
The canonical SMILES for 1-ethyl-4,4-difluoro-N-methylsulfonylpyrrolidine-2-carboxamide is CCN1CC(F)(F)CC1C(=O)NS(C)(=O)=O.
What is the InChIKey of 1-ethyl-4,4-difluoro-N-methylsulfonylpyrrolidine-2-carboxamide?
The InChIKey is MKXBXKRRLLOQOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F2N2O3S/c1-3-12-5-8(9,10)4-6(12)7(13)11-16(2,14)15/h6H,3-5H2,1-2H3,(H,11,13).
What are the key properties of 1-ethyl-4,4-difluoro-N-methylsulfonylpyrrolidine-2-carboxamide?
1-ethyl-4,4-difluoro-N-methylsulfonylpyrrolidine-2-carboxamide has a molecular weight of 256.27 g/mol, XLogP of -0.21, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4,4-difluoro-N-methylsulfonylpyrrolidine-2-carboxamide is sourced from PubChem (CID 126480634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).