C16H15NO4S — CID 126480885
1-(benzenesulfonyl)-3,4-dihydro-2H-quinoline-3-carboxylic acid (PubChem CID 126480885) has the molecular formula C16H15NO4S and a molecular weight of 317.37 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3,4-dihydro-2H-quinoline-3-carboxylic acid.
| Compound Name | 1-(benzenesulfonyl)-3,4-dihydro-2H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 126480885 |
| Molecular Formula | C16H15NO4S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 1-(benzenesulfonyl)-3,4-dihydro-2H-quinoline-3-carboxylic acid |
| SMILES | O=C(O)C1Cc2ccccc2N(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C16H15NO4S/c18-16(19)13-10-12-6-4-5-9-15(12)17(11-13)22(20,21)14-7-2-1-3-8-14/h1-9,13H,10-11H2,(H,18,19) |
| InChIKey | NABDTTIMVPANIP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |