C11H19N — CID 126480910
(3E)-N,N,3,4,5-pentamethylhexa-1,3,5-trien-2-amine (PubChem CID 126480910) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is (3E)-N,N,3,4,5-pentamethylhexa-1,3,5-trien-2-amine.
| Compound Name | (3E)-N,N,3,4,5-pentamethylhexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 126480910 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (3E)-N,N,3,4,5-pentamethylhexa-1,3,5-trien-2-amine |
| SMILES | C=C(C)/C(C)=C(\C)C(=C)N(C)C |
| InChI | InChI=1S/C11H19N/c1-8(2)9(3)10(4)11(5)12(6)7/h1,5H2,2-4,6-7H3/b10-9+ |
| InChIKey | WEZOZYXXVQPGKN-MDZDMXLPSA-N |
| XLogP | 2.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|