C23H31N2O3P — CID 126481215
6-[[(2,4-dimethylphenyl)methyl-ethoxyphosphoryl]amino]-1-propyl-3,4-dihydroquinolin-2-one (PubChem CID 126481215) has the molecular formula C23H31N2O3P and a molecular weight of 414.49 g/mol. Its IUPAC name is 6-[[(2,4-dimethylphenyl)methyl-ethoxyphosphoryl]amino]-1-propyl-3,4-dihydroquinolin-2-one.
| Compound Name | 6-[[(2,4-dimethylphenyl)methyl-ethoxyphosphoryl]amino]-1-propyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 126481215 |
| Molecular Formula | C23H31N2O3P |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 6-[[(2,4-dimethylphenyl)methyl-ethoxyphosphoryl]amino]-1-propyl-3,4-dihydroquinolin-2-one |
| SMILES | CCCN1C(=O)CCc2cc(NP(=O)(Cc3ccc(C)cc3C)OCC)ccc21 |
| InChI | InChI=1S/C23H31N2O3P/c1-5-13-25-22-11-10-21(15-19(22)9-12-23(25)26)24-29(27,28-6-2)16-20-8-7-17(3)14-18(20)4/h7-8,10-11,14-15H,5-6,9,12-13,16H2,1-4H3,(H,24,27) |
| InChIKey | CPLVXDASFYJGQP-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|