About 2-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-4-fluorophenyl]-2-iminoacetaldehyde
2-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-4-fluorophenyl]-2-iminoacetaldehyde (PubChem CID 126481444) has the molecular formula C15H12Cl2FN3O2
and a molecular weight of 356.18 g/mol. Its IUPAC name is 2-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-4-fluorophenyl]-2-iminoacetaldehyde.
Molecular Properties
| Compound Name | 2-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-4-fluorophenyl]-2-iminoacetaldehyde |
| PubChem CID | 126481444 |
| Molecular Formula | C15H12Cl2FN3O2 |
| Molecular Weight | 356.18 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 2-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-4-fluorophenyl]-2-iminoacetaldehyde |
| SMILES | [H]/N=C(\C=O)c1cc(OC(C)c2c(Cl)cncc2Cl)c(F)cc1N |
| InChI | InChI=1S/C15H12Cl2FN3O2/c1-7(15-9(16)4-21-5-10(15)17)23-14-2-8(13(20)6-22)12(19)3-11(14)18/h2-7,20H,19H2,1H3/b20-13+ |
| InChIKey | VCJJCEFEPRZZFE-DEDYPNTBSA-N |
| XLogP | 3.82 |
| TPSA | 89.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.18 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-4-fluorophenyl]-2-iminoacetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-4-fluorophenyl]-2-iminoacetaldehyde?
The IUPAC name of 2-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-4-fluorophenyl]-2-iminoacetaldehyde (CID 126481444) is 2-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-4-fluorophenyl]-2-iminoacetaldehyde.
What is the SMILES notation for 2-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-4-fluorophenyl]-2-iminoacetaldehyde?
The canonical SMILES for 2-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-4-fluorophenyl]-2-iminoacetaldehyde is [H]/N=C(\C=O)c1cc(OC(C)c2c(Cl)cncc2Cl)c(F)cc1N.
What is the InChIKey of 2-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-4-fluorophenyl]-2-iminoacetaldehyde?
The InChIKey is VCJJCEFEPRZZFE-DEDYPNTBSA-N. The full InChI is InChI=1S/C15H12Cl2FN3O2/c1-7(15-9(16)4-21-5-10(15)17)23-14-2-8(13(20)6-22)12(19)3-11(14)18/h2-7,20H,19H2,1H3/b20-13+.
What are the key properties of 2-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-4-fluorophenyl]-2-iminoacetaldehyde?
2-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-4-fluorophenyl]-2-iminoacetaldehyde has a molecular weight of 356.18 g/mol, XLogP of 3.82, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-4-fluorophenyl]-2-iminoacetaldehyde is sourced from PubChem (CID 126481444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).