C28H25FO4 — CID 126481505
(3aR,6aR)-5-fluoro-2,2-dimethyl-6-(trityloxymethyl)-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-one (PubChem CID 126481505) has the molecular formula C28H25FO4 and a molecular weight of 444.50 g/mol. Its IUPAC name is (3aR,6aR)-5-fluoro-2,2-dimethyl-6-(trityloxymethyl)-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-one.
| Compound Name | (3aR,6aR)-5-fluoro-2,2-dimethyl-6-(trityloxymethyl)-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 126481505 |
| Molecular Formula | C28H25FO4 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | (3aR,6aR)-5-fluoro-2,2-dimethyl-6-(trityloxymethyl)-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-one |
| SMILES | CC1(C)O[C@@H]2C(COC(c3ccccc3)(c3ccccc3)c3ccccc3)=C(F)C(=O)[C@@H]2O1 |
| InChI | InChI=1S/C28H25FO4/c1-27(2)32-25-22(23(29)24(30)26(25)33-27)18-31-28(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-17,25-26H,18H2,1-2H3/t25-,26+/m1/s1 |
| InChIKey | XKQFBYUKBAOLLP-FTJBHMTQSA-N |
| XLogP | 5.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|