C28H29FO5 — CID 126481584
2-fluoro-1-[(4R,5R)-5-(1-hydroxy-2-trityloxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanone (PubChem CID 126481584) has the molecular formula C28H29FO5 and a molecular weight of 464.53 g/mol. Its IUPAC name is 2-fluoro-1-[(4R,5R)-5-(1-hydroxy-2-trityloxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanone.
| Compound Name | 2-fluoro-1-[(4R,5R)-5-(1-hydroxy-2-trityloxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanone |
|---|---|
| PubChem CID | 126481584 |
| Molecular Formula | C28H29FO5 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 2-fluoro-1-[(4R,5R)-5-(1-hydroxy-2-trityloxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanone |
| SMILES | CC1(C)O[C@H](C(O)COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H](C(=O)CF)O1 |
| InChI | InChI=1S/C28H29FO5/c1-27(2)33-25(23(30)18-29)26(34-27)24(31)19-32-28(20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-17,24-26,31H,18-19H2,1-2H3/t24?,25-,26+/m0/s1 |
| InChIKey | KPAMHWDQRJMTPS-XBCLTQTASA-N |
| XLogP | 4.41 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|