C28H27FO5 — CID 126481587
1-[(4S,5R)-5-(2-fluoroacetyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-trityloxyethanone (PubChem CID 126481587) has the molecular formula C28H27FO5 and a molecular weight of 462.52 g/mol. Its IUPAC name is 1-[(4S,5R)-5-(2-fluoroacetyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-trityloxyethanone.
| Compound Name | 1-[(4S,5R)-5-(2-fluoroacetyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-trityloxyethanone |
|---|---|
| PubChem CID | 126481587 |
| Molecular Formula | C28H27FO5 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 1-[(4S,5R)-5-(2-fluoroacetyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-trityloxyethanone |
| SMILES | CC1(C)O[C@H](C(=O)COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H](C(=O)CF)O1 |
| InChI | InChI=1S/C28H27FO5/c1-27(2)33-25(23(30)18-29)26(34-27)24(31)19-32-28(20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-17,25-26H,18-19H2,1-2H3/t25-,26+/m0/s1 |
| InChIKey | MUBIQQXNHZHTNX-IZZNHLLZSA-N |
| XLogP | 4.62 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|