C26H30F3N3O4 — CID 126481776
3-[1-[(1R,4R,5S)-4-hydroxy-3,3,5-trimethylcyclohexyl]-2-[4-(trifluoromethoxy)anilino]benzimidazol-5-yl]propanoic acid (PubChem CID 126481776) has the molecular formula C26H30F3N3O4 and a molecular weight of 505.54 g/mol. Its IUPAC name is 3-[1-[(1R,4R,5S)-4-hydroxy-3,3,5-trimethylcyclohexyl]-2-[4-(trifluoromethoxy)anilino]benzimidazol-5-yl]propanoic acid.
| Compound Name | 3-[1-[(1R,4R,5S)-4-hydroxy-3,3,5-trimethylcyclohexyl]-2-[4-(trifluoromethoxy)anilino]benzimidazol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 126481776 |
| Molecular Formula | C26H30F3N3O4 |
| Molecular Weight | 505.54 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 3-[1-[(1R,4R,5S)-4-hydroxy-3,3,5-trimethylcyclohexyl]-2-[4-(trifluoromethoxy)anilino]benzimidazol-5-yl]propanoic acid |
| SMILES | C[C@H]1C[C@@H](n2c(Nc3ccc(OC(F)(F)F)cc3)nc3cc(CCC(=O)O)ccc32)CC(C)(C)[C@@H]1O |
| InChI | InChI=1S/C26H30F3N3O4/c1-15-12-18(14-25(2,3)23(15)35)32-21-10-4-16(5-11-22(33)34)13-20(21)31-24(32)30-17-6-8-19(9-7-17)36-26(27,28)29/h4,6-10,13,15,18,23,35H,5,11-12,14H2,1-3H3,(H,30,31)(H,33,34)/t15-,18+,23+/m0/s1 |
| InChIKey | BBMYLUZDKNJFQH-TUVUNVSASA-N |
| XLogP | 6.05 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.54 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |